CAS 119386-71-9 appears in our catalog under these names: 2,2'-(cis-1,2-Diaminoethane-1,2-diyl)diphenol, 98%, (1S,2S)-1,2-BIS(2-HYDROXYPHENYL)ETHYLEN&, (-)-2,2`-((1S,2S)-1,2-DIAMINOETHANE-1,2-DIYL)-DIPHENOL, 98%, ee99%. Offered by: AmBeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 10g, 1G, 250mg, 5g.
2-[1,2-diamino-2-(2-hydroxyphenyl)ethyl]phenol (CAS 119386-71-9) is a chemical compound with the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. IUPAC name: 2-[1,2-diamino-2-(2-hydroxyphenyl)ethyl]phenol. InChIKey: MRNPLGLZBUDMRE-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O2 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 2-[1,2-diamino-2-(2-hydroxyphenyl)ethyl]phenol |
| InChIKey | MRNPLGLZBUDMRE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(C2=CC=CC=C2O)N)N)O |
Computed by PubChem (NCBI)