CAS 119389-05-8 appears in our catalog under these names: 5–(Phenylethynyl)isobenzofuran–1,3–dione, 4-Phenylethynylphthalic Anhydride, >98.0%(GC)(T), 5-(Phenylethynyl)isobenzofuran-1,3-dione 97%, 4-(Phenylethynyl)phthalic anhydride, 98%, 98%, 5-(Phenylethynyl)isobenzofuran-1,3-dione, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 500g, 1g, 100g, 50g.
5-(2-phenylethynyl)-2-benzofuran-1,3-dione (CAS 119389-05-8) is a chemical compound with the molecular formula C16H8O3 and a molecular weight of 248.23 g/mol. IUPAC name: 5-(2-phenylethynyl)-2-benzofuran-1,3-dione. InChIKey: UPGRRPUXXWPEMV-UHFFFAOYSA-N.
| Molecular formula | C16H8O3 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | 5-(2-phenylethynyl)-2-benzofuran-1,3-dione |
| InChIKey | UPGRRPUXXWPEMV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC2=CC3=C(C=C2)C(=O)OC3=O |
Computed by PubChem (NCBI)