CAS 6812-14-2 appears in our catalog under these names: 2,3-Anthracenedicarboxylic anhydride, 95%, Anthra(2,3-c)furan-1,3-dione, 93%, 2,3–Anthracenedicarboxylic Anhydride, 2,3-Anthracenedicarboxylic anhydride, 2,3-Anthracenedicarboxylic Anhydride, >93.0%(GC). Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, TCI. Available pack sizes: 250mg, 100mg, 25mg, 0,25g, 500mg.
Naphtho[2,3-f][2]benzofuran-1,3-dione (CAS 6812-14-2) is a chemical compound with the molecular formula C16H8O3 and a molecular weight of 248.23 g/mol. IUPAC name: naphtho[2,3-f][2]benzofuran-1,3-dione. InChIKey: AJXNLGUENUIIRW-UHFFFAOYSA-N.
| Molecular formula | C16H8O3 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | naphtho[2,3-f][2]benzofuran-1,3-dione |
| InChIKey | AJXNLGUENUIIRW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C=C4C(=CC3=CC2=C1)C(=O)OC4=O |
Computed by PubChem (NCBI)