Products 1194375-68-2
CAS 1194375-68-2 is the registry number for tert-Butyl 4-iodoisoindoline-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-iodo-1,3-dihydroisoindole-2-carboxylate (CAS 1194375-68-2) is a chemical compound with the molecular formula C13H16INO2 and a molecular weight of 345.18 g/mol. IUPAC name: tert-butyl 4-iodo-1,3-dihydroisoindole-2-carboxylate. InChIKey: IJQNFDQTNZEHSV-UHFFFAOYSA-N.
| Molecular formula | C13H16INO2 |
|---|---|
| Molecular weight | 345.18 g/mol |
| IUPAC name | tert-butyl 4-iodo-1,3-dihydroisoindole-2-carboxylate |
| InChIKey | IJQNFDQTNZEHSV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)C(=CC=C2)I |
Computed by PubChem (NCBI)