Products 1156334-52-9
CAS 1156334-52-9 is the registry number for (2-(Hydroxymethyl)piperidin-1-yl)(4-iodophenyl)methanone, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-(hydroxymethyl)piperidin-1-yl]-(4-iodophenyl)methanone (CAS 1156334-52-9) is a chemical compound with the molecular formula C13H16INO2 and a molecular weight of 345.18 g/mol. IUPAC name: [2-(hydroxymethyl)piperidin-1-yl]-(4-iodophenyl)methanone. InChIKey: CTCFZGFYFBWTMJ-UHFFFAOYSA-N.
| Molecular formula | C13H16INO2 |
|---|---|
| Molecular weight | 345.18 g/mol |
| IUPAC name | [2-(hydroxymethyl)piperidin-1-yl]-(4-iodophenyl)methanone |
| InChIKey | CTCFZGFYFBWTMJ-UHFFFAOYSA-N |
| SMILES | C1CCN(C(C1)CO)C(=O)C2=CC=C(C=C2)I |
Computed by PubChem (NCBI)