CAS 1131614-61-3 is the registry number for 3–Iodo–4–(piperidin–1–ylmethyl)benzoic acid. Offered by: GLPBio. Available pack sizes: 100mg.
3-iodo-4-(piperidin-1-ylmethyl)benzoic acid (CAS 1131614-61-3) is a chemical compound with the molecular formula C13H16INO2 and a molecular weight of 345.18 g/mol. IUPAC name: 3-iodo-4-(piperidin-1-ylmethyl)benzoic acid. InChIKey: ZYPGVRYZSLQUJP-UHFFFAOYSA-N.
| Molecular formula | C13H16INO2 |
|---|---|
| Molecular weight | 345.18 g/mol |
| IUPAC name | 3-iodo-4-(piperidin-1-ylmethyl)benzoic acid |
| InChIKey | ZYPGVRYZSLQUJP-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CC2=C(C=C(C=C2)C(=O)O)I |
Computed by PubChem (NCBI)