CAS 1194508-28-5 appears in our catalog under these names: 2-Benzyl-2,6-diazaspiro(3.3)heptane, 98+%, 2–Benzyl–2，6–diazaspiro(3·3)heptane, 2-Benzyl-2,6-diazaspiro(3.3)heptane. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-benzyl-2,6-diazaspiro[3.3]heptane (CAS 1194508-28-5) is a chemical compound with the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. IUPAC name: 2-benzyl-2,6-diazaspiro[3.3]heptane. InChIKey: BSGJWDYVBDFDFI-UHFFFAOYSA-N.
| Molecular formula | C12H16N2 |
|---|---|
| Molecular weight | 188.27 g/mol |
| IUPAC name | 2-benzyl-2,6-diazaspiro[3.3]heptane |
| InChIKey | BSGJWDYVBDFDFI-UHFFFAOYSA-N |
| SMILES | C1C2(CN1)CN(C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)