CAS 119472-66-1 is the registry number for 4-Methylcyclohex-1-en-1-yl trifluoromethanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-methylcyclohexen-1-yl) trifluoromethanesulfonate (CAS 119472-66-1) is a chemical compound with the molecular formula C8H11F3O3S and a molecular weight of 244.23 g/mol. IUPAC name: (4-methylcyclohexen-1-yl) trifluoromethanesulfonate. InChIKey: PXUKYBBJDOSNMG-UHFFFAOYSA-N.
| Molecular formula | C8H11F3O3S |
|---|---|
| Molecular weight | 244.23 g/mol |
| IUPAC name | (4-methylcyclohexen-1-yl) trifluoromethanesulfonate |
| InChIKey | PXUKYBBJDOSNMG-UHFFFAOYSA-N |
| SMILES | CC1CCC(=CC1)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)