CAS 32363-21-6 is the registry number for 2-Methyl-1-cyclohexenyl triflate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g.
(2-methylcyclohexen-1-yl) trifluoromethanesulfonate (CAS 32363-21-6) is a chemical compound with the molecular formula C8H11F3O3S and a molecular weight of 244.23 g/mol. IUPAC name: (2-methylcyclohexen-1-yl) trifluoromethanesulfonate. InChIKey: HSGJMDJLDHZPAZ-UHFFFAOYSA-N.
| Molecular formula | C8H11F3O3S |
|---|---|
| Molecular weight | 244.23 g/mol |
| IUPAC name | (2-methylcyclohexen-1-yl) trifluoromethanesulfonate |
| InChIKey | HSGJMDJLDHZPAZ-UHFFFAOYSA-N |
| SMILES | CC1=C(CCCC1)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)