Products 32363-21-6

CAS 32363-21-6 is the registry number for 2-Methyl-1-cyclohexenyl triflate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

(2-methylcyclohexen-1-yl) trifluoromethanesulfonate (CAS 32363-21-6) is a chemical compound with the molecular formula C8H11F3O3S and a molecular weight of 244.23 g/mol. IUPAC name: (2-methylcyclohexen-1-yl) trifluoromethanesulfonate. InChIKey: HSGJMDJLDHZPAZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11F3O3S
Molecular weight244.23 g/mol
IUPAC name(2-methylcyclohexen-1-yl) trifluoromethanesulfonate
InChIKeyHSGJMDJLDHZPAZ-UHFFFAOYSA-N
SMILESCC1=C(CCCC1)OS(=O)(=O)C(F)(F)F

Computed by PubChem (NCBI)