Products 1194720-88-1

CAS 1194720-88-1 is the registry number for Methyl 4-(dimethylamino)-3-hydroxybenzoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 4-(dimethylamino)-3-hydroxybenzoate (CAS 1194720-88-1) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: methyl 4-(dimethylamino)-3-hydroxybenzoate. InChIKey: NURAZZPTWZJPLA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO3
Molecular weight195.21 g/mol
IUPAC namemethyl 4-(dimethylamino)-3-hydroxybenzoate
InChIKeyNURAZZPTWZJPLA-UHFFFAOYSA-N
SMILESCN(C)C1=C(C=C(C=C1)C(=O)OC)O

Computed by PubChem (NCBI)