CAS 1194720-88-1 is the registry number for Methyl 4-(dimethylamino)-3-hydroxybenzoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 4-(dimethylamino)-3-hydroxybenzoate (CAS 1194720-88-1) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: methyl 4-(dimethylamino)-3-hydroxybenzoate. InChIKey: NURAZZPTWZJPLA-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | methyl 4-(dimethylamino)-3-hydroxybenzoate |
| InChIKey | NURAZZPTWZJPLA-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)C(=O)OC)O |
Computed by PubChem (NCBI)