Products 1195-13-7
CAS 1195-13-7 is the registry number for rac-(3aR,7aR)-Octahydro-1H-indol-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3aR,7aR)-1,3,3a,4,5,6,7,7a-octahydroindol-2-one (CAS 1195-13-7) is a chemical compound with the molecular formula C8H13NO and a molecular weight of 139.19 g/mol. IUPAC name: (3aR,7aR)-1,3,3a,4,5,6,7,7a-octahydroindol-2-one. InChIKey: GFOOVKOSROWXAZ-RNFRBKRXSA-N.
| Molecular formula | C8H13NO |
|---|---|
| Molecular weight | 139.19 g/mol |
| IUPAC name | (3aR,7aR)-1,3,3a,4,5,6,7,7a-octahydroindol-2-one |
| InChIKey | GFOOVKOSROWXAZ-RNFRBKRXSA-N |
| SMILES | C1CC[C@@H]2[C@H](C1)CC(=O)N2 |
Computed by PubChem (NCBI)