CAS 119516-83-5 appears in our catalog under these names: 1,4-Phenylenediamine-d4, 1,4-Benzene-d4-diamine, 98 atom % D, min 98% Chemical Purity, 1,4-PHENYLENEDIAMINE-2,3,5,6-D4,. Offered by: TRC, CDN, Sigma-Aldrich. Available pack sizes: 100mg, 10mg, 1g, 0,5g, 0,25g.
2,3,5,6-tetradeuteriobenzene-1,4-diamine (CAS 119516-83-5) is a chemical compound with the molecular formula C6H8N2 and a molecular weight of 112.17 g/mol. IUPAC name: 2,3,5,6-tetradeuteriobenzene-1,4-diamine. InChIKey: CBCKQZAAMUWICA-RHQRLBAQSA-N.
| Molecular formula | C6H8N2 |
|---|---|
| Molecular weight | 112.17 g/mol |
| IUPAC name | 2,3,5,6-tetradeuteriobenzene-1,4-diamine |
| InChIKey | CBCKQZAAMUWICA-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])[2H])N)[2H] |
Computed by PubChem (NCBI)