Products 45619-88-3

CAS 45619-88-3 is the registry number for 1,4-Benzenediamine-d8, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.

Structural formula: {0} (CAS {1})

1-N,1-N,4-N,4-N,2,3,5,6-octadeuteriobenzene-1,4-diamine (CAS 45619-88-3) is a chemical compound with the molecular formula C6H8N2 and a molecular weight of 116.19 g/mol. IUPAC name: 1-N,1-N,4-N,4-N,2,3,5,6-octadeuteriobenzene-1,4-diamine. InChIKey: CBCKQZAAMUWICA-GCJHLHDMSA-N.

Identity
Molecular formulaC6H8N2
Molecular weight116.19 g/mol
IUPAC name1-N,1-N,4-N,4-N,2,3,5,6-octadeuteriobenzene-1,4-diamine
InChIKeyCBCKQZAAMUWICA-GCJHLHDMSA-N
SMILES[2H]C1=C(C(=C(C(=C1N([2H])[2H])[2H])[2H])N([2H])[2H])[2H]

Computed by PubChem (NCBI)