Products 119516-85-7
CAS 119516-85-7 appears in our catalog under these names: 1-(3,5-Dimethylphenyl)-2,5-dimethyl-1h-pyrrole, 95%, 1-(3,5-Dimethylphenyl)-2,5-dimethyl-1H-pyrrole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
1-(3,5-dimethylphenyl)-2,5-dimethylpyrrole (CAS 119516-85-7) is a chemical compound with the molecular formula C14H17N and a molecular weight of 199.29 g/mol. IUPAC name: 1-(3,5-dimethylphenyl)-2,5-dimethylpyrrole. InChIKey: VOPJKGKCDWFVCZ-UHFFFAOYSA-N.
| Molecular formula | C14H17N |
|---|---|
| Molecular weight | 199.29 g/mol |
| IUPAC name | 1-(3,5-dimethylphenyl)-2,5-dimethylpyrrole |
| InChIKey | VOPJKGKCDWFVCZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC(=CC(=C2)C)C)C |
Computed by PubChem (NCBI)