CAS 86926-16-1 is the registry number for (R)-N,N-Dimethyl-1-(naphthalen-1-yl)ethanamine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-N,N-dimethyl-1-naphthalen-1-ylethanamine (CAS 86926-16-1) is a chemical compound with the molecular formula C14H17N and a molecular weight of 199.29 g/mol. IUPAC name: (1R)-N,N-dimethyl-1-naphthalen-1-ylethanamine. InChIKey: AXRXYILTIWBHEP-LLVKDONJSA-N.
| Molecular formula | C14H17N |
|---|---|
| Molecular weight | 199.29 g/mol |
| IUPAC name | (1R)-N,N-dimethyl-1-naphthalen-1-ylethanamine |
| InChIKey | AXRXYILTIWBHEP-LLVKDONJSA-N |
| SMILES | C[C@H](C1=CC=CC2=CC=CC=C21)N(C)C |
Computed by PubChem (NCBI)