CAS 1195164-29-4 is the registry number for 3-(4-Methylthiobenzoyl)propionic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
4-(4-methylphenyl)-4-sulfanylidenebutanoic acid (CAS 1195164-29-4) is a chemical compound with the molecular formula C11H12O2S and a molecular weight of 208.28 g/mol. IUPAC name: 4-(4-methylphenyl)-4-sulfanylidenebutanoic acid. InChIKey: XYBRQJBAQJTWPM-UHFFFAOYSA-N.
| Molecular formula | C11H12O2S |
|---|---|
| Molecular weight | 208.28 g/mol |
| IUPAC name | 4-(4-methylphenyl)-4-sulfanylidenebutanoic acid |
| InChIKey | XYBRQJBAQJTWPM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=S)CCC(=O)O |
Computed by PubChem (NCBI)