CAS 1655509-31-1 is the registry number for (E)-3-(4,5,6,7-Tetrahydrobenzo[b]thiophen-3-yl)acrylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)prop-2-enoic acid (CAS 1655509-31-1) is a chemical compound with the molecular formula C11H12O2S and a molecular weight of 208.28 g/mol. IUPAC name: (E)-3-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)prop-2-enoic acid. InChIKey: YNUHARQVSMGMJZ-AATRIKPKSA-N.
| Molecular formula | C11H12O2S |
|---|---|
| Molecular weight | 208.28 g/mol |
| IUPAC name | (E)-3-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)prop-2-enoic acid |
| InChIKey | YNUHARQVSMGMJZ-AATRIKPKSA-N |
| SMILES | C1CCC2=C(C1)C(=CS2)/C=C/C(=O)O |
Computed by PubChem (NCBI)