CAS 1195231-50-5 is the registry number for rel-(1R,5R)-2,6,6-Trimethylbicyclo(3.1.1)heptane, 98%. Offered by: AmBeed. Available pack sizes: 500g.
(1R,5R)-2,6,6-trimethylbicyclo[3.1.1]heptane (CAS 1195231-50-5) is a chemical compound with the molecular formula C10H18 and a molecular weight of 138.25 g/mol. IUPAC name: (1R,5R)-2,6,6-trimethylbicyclo[3.1.1]heptane. InChIKey: XOKSLPVRUOBDEW-CFCGPWAMSA-N.
| Molecular formula | C10H18 |
|---|---|
| Molecular weight | 138.25 g/mol |
| IUPAC name | (1R,5R)-2,6,6-trimethylbicyclo[3.1.1]heptane |
| InChIKey | XOKSLPVRUOBDEW-CFCGPWAMSA-N |
| SMILES | CC1CC[C@@H]2C[C@H]1C2(C)C |
Computed by PubChem (NCBI)