CAS 6876-13-7 appears in our catalog under these names: rel-(1S,2R,5S)-2,6,6-Trimethylbicyclo[3.1.1]heptane 98%, rel-(1S,2R,5S)-2,6,6-Trimethylbicyclo[3.1.1]heptane, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 25g, 100g, 5g.
(1S,2R,5S)-2,6,6-trimethylbicyclo[3.1.1]heptane (CAS 6876-13-7) is a chemical compound with the molecular formula C10H18 and a molecular weight of 138.25 g/mol. IUPAC name: (1S,2R,5S)-2,6,6-trimethylbicyclo[3.1.1]heptane. InChIKey: XOKSLPVRUOBDEW-VGMNWLOBSA-N.
| Molecular formula | C10H18 |
|---|---|
| Molecular weight | 138.25 g/mol |
| IUPAC name | (1S,2R,5S)-2,6,6-trimethylbicyclo[3.1.1]heptane |
| InChIKey | XOKSLPVRUOBDEW-VGMNWLOBSA-N |
| SMILES | C[C@@H]1CC[C@H]2C[C@@H]1C2(C)C |
Computed by PubChem (NCBI)