CAS 1195260-99-1 is the registry number for H-L-Phe(4-NEt2)-OH. Offered by: Iris Biotech. Available pack sizes: 50mg, 250mg.
(2S)-2-amino-3-[4-(diethylamino)phenyl]propanoic acid (CAS 1195260-99-1) is a chemical compound with the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. IUPAC name: (2S)-2-amino-3-[4-(diethylamino)phenyl]propanoic acid. InChIKey: HMBDYJBUJGEPQD-LBPRGKRZSA-N.
| Molecular formula | C13H20N2O2 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | (2S)-2-amino-3-[4-(diethylamino)phenyl]propanoic acid |
| InChIKey | HMBDYJBUJGEPQD-LBPRGKRZSA-N |
| SMILES | CCN(CC)C1=CC=C(C=C1)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)