Products 1195944-92-3

CAS 1195944-92-3 is the registry number for 3-[2-(3-Bromo-phenyl)-ethoxy]-4-methoxy-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 3-[2-(3-bromophenyl)ethoxy]-4-methoxybenzoate (CAS 1195944-92-3) is a chemical compound with the molecular formula C17H17BrO4 and a molecular weight of 365.2 g/mol. IUPAC name: methyl 3-[2-(3-bromophenyl)ethoxy]-4-methoxybenzoate. InChIKey: XUIOFFFOOFCDDM-UHFFFAOYSA-N.

Identity
Molecular formulaC17H17BrO4
Molecular weight365.2 g/mol
IUPAC namemethyl 3-[2-(3-bromophenyl)ethoxy]-4-methoxybenzoate
InChIKeyXUIOFFFOOFCDDM-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)C(=O)OC)OCCC2=CC(=CC=C2)Br

Computed by PubChem (NCBI)