CAS 160889-18-9 appears in our catalog under these names: Salmeterol Impurity 2, Methyl (R)-5-(2-bromo-1-hydroxyethyl)-2-(phenylmethoxy)benzoate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
Methyl 5-[(1R)-2-bromo-1-hydroxyethyl]-2-phenylmethoxybenzoate (CAS 160889-18-9) is a chemical compound with the molecular formula C17H17BrO4 and a molecular weight of 365.2 g/mol. IUPAC name: methyl 5-[(1R)-2-bromo-1-hydroxyethyl]-2-phenylmethoxybenzoate. InChIKey: YDZXPQYEBGUSPC-HNNXBMFYSA-N.
| Molecular formula | C17H17BrO4 |
|---|---|
| Molecular weight | 365.2 g/mol |
| IUPAC name | methyl 5-[(1R)-2-bromo-1-hydroxyethyl]-2-phenylmethoxybenzoate |
| InChIKey | YDZXPQYEBGUSPC-HNNXBMFYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)[C@H](CBr)O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)