CAS 1196-41-4 appears in our catalog under these names: 2,6-Dibromopurine, 2,6–Dibromopurine. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 1g.
2,6-dibromo-7H-purine (CAS 1196-41-4) is a chemical compound with the molecular formula C5H2Br2N4 and a molecular weight of 277.90 g/mol. IUPAC name: 2,6-dibromo-7H-purine. InChIKey: YPFDNCJJFMAZPJ-UHFFFAOYSA-N.
| Molecular formula | C5H2Br2N4 |
|---|---|
| Molecular weight | 277.90 g/mol |
| IUPAC name | 2,6-dibromo-7H-purine |
| InChIKey | YPFDNCJJFMAZPJ-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=NC(=N2)Br)Br |
Computed by PubChem (NCBI)