CAS 1823624-52-7 is the registry number for 2,6-Dibromo-[1,2,4]triazolo[1,5-a]pyrazine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,6-dibromo-[1,2,4]triazolo[1,5-a]pyrazine (CAS 1823624-52-7) is a chemical compound with the molecular formula C5H2Br2N4 and a molecular weight of 277.90 g/mol. IUPAC name: 2,6-dibromo-[1,2,4]triazolo[1,5-a]pyrazine. InChIKey: BAJUHIQABQGBLO-UHFFFAOYSA-N.
| Molecular formula | C5H2Br2N4 |
|---|---|
| Molecular weight | 277.90 g/mol |
| IUPAC name | 2,6-dibromo-[1,2,4]triazolo[1,5-a]pyrazine |
| InChIKey | BAJUHIQABQGBLO-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC2=NC(=NN21)Br)Br |
Computed by PubChem (NCBI)