Products 1196147-20-2

CAS 1196147-20-2 is the registry number for Methyl 4-amino-2-chloro-1,3-thiazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 0,05g, 0,1g.

Structural formula: {0} (CAS {1})

Methyl 4-amino-2-chloro-1,3-thiazole-5-carboxylate (CAS 1196147-20-2) is a chemical compound with the molecular formula C5H5ClN2O2S and a molecular weight of 192.62 g/mol. IUPAC name: methyl 4-amino-2-chloro-1,3-thiazole-5-carboxylate. InChIKey: XJEGTQDOGZSFKN-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5ClN2O2S
Molecular weight192.62 g/mol
IUPAC namemethyl 4-amino-2-chloro-1,3-thiazole-5-carboxylate
InChIKeyXJEGTQDOGZSFKN-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(N=C(S1)Cl)N

Computed by PubChem (NCBI)