CAS 1196151-36-6 appears in our catalog under these names: 5-(Trifluoromethyl)pyrazine-2-carbaldehyde, 97%, 5-(Trifluoromethyl)-2-pyrazinecarboxaldehyde, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 50mg, 100mg, 250mg, 1g.
5-(trifluoromethyl)pyrazine-2-carbaldehyde (CAS 1196151-36-6) is a chemical compound with the molecular formula C6H3F3N2O and a molecular weight of 176.10 g/mol. IUPAC name: 5-(trifluoromethyl)pyrazine-2-carbaldehyde. InChIKey: AIMGDDYGZCDYNK-UHFFFAOYSA-N.
| Molecular formula | C6H3F3N2O |
|---|---|
| Molecular weight | 176.10 g/mol |
| IUPAC name | 5-(trifluoromethyl)pyrazine-2-carbaldehyde |
| InChIKey | AIMGDDYGZCDYNK-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC(=N1)C(F)(F)F)C=O |
Computed by PubChem (NCBI)