CAS 1197238-20-2 appears in our catalog under these names: 3-(Trifluoromethyl)pyrazine-2-carbaldehyde, 3-(Trifluoromethyl)pyrazine-2-carbaldehyde, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 0,5g, 50mg, 1g, 5g, 250mg.
3-(trifluoromethyl)pyrazine-2-carbaldehyde (CAS 1197238-20-2) is a chemical compound with the molecular formula C6H3F3N2O and a molecular weight of 176.10 g/mol. IUPAC name: 3-(trifluoromethyl)pyrazine-2-carbaldehyde. InChIKey: JSRSQMKEQWBMMV-UHFFFAOYSA-N.
| Molecular formula | C6H3F3N2O |
|---|---|
| Molecular weight | 176.10 g/mol |
| IUPAC name | 3-(trifluoromethyl)pyrazine-2-carbaldehyde |
| InChIKey | JSRSQMKEQWBMMV-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=N1)C=O)C(F)(F)F |
Computed by PubChem (NCBI)