Products 1196155-07-3
CAS 1196155-07-3 is the registry number for tert-butyl 3-amino-6-isopropyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5(1H)-carboxylate, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl 3-amino-6-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate (CAS 1196155-07-3) is a chemical compound with the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. IUPAC name: tert-butyl 3-amino-6-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate. InChIKey: BGXWEOOVPZIQDT-UHFFFAOYSA-N.
| Molecular formula | C13H22N4O2 |
|---|---|
| Molecular weight | 266.34 g/mol |
| IUPAC name | tert-butyl 3-amino-6-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate |
| InChIKey | BGXWEOOVPZIQDT-UHFFFAOYSA-N |
| SMILES | CC(C)C1C2=C(CN1C(=O)OC(C)(C)C)C(=NN2)N |
Computed by PubChem (NCBI)