CAS 1196155-62-0 appears in our catalog under these names: 1-(4-(Trifluoromethyl)pyrimidin-2-yl)ethanamine hydrochloride, 95%, 1-(4-(Trifluoromethyl)pyrimidin-2-yl)ethan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-[4-(trifluoromethyl)pyrimidin-2-yl]ethanamine;hydrochloride (CAS 1196155-62-0) is a chemical compound with the molecular formula C7H9ClF3N3 and a molecular weight of 227.61 g/mol. IUPAC name: 1-[4-(trifluoromethyl)pyrimidin-2-yl]ethanamine;hydrochloride. InChIKey: QIYILNSEVXDVLY-UHFFFAOYSA-N.
| Molecular formula | C7H9ClF3N3 |
|---|---|
| Molecular weight | 227.61 g/mol |
| IUPAC name | 1-[4-(trifluoromethyl)pyrimidin-2-yl]ethanamine;hydrochloride |
| InChIKey | QIYILNSEVXDVLY-UHFFFAOYSA-N |
| SMILES | CC(C1=NC=CC(=N1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)