CAS 1948237-01-1 is the registry number for (S)-1-(2-(Trifluoromethyl)pyrimidin-5-yl)ethanamine hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(1S)-1-[2-(trifluoromethyl)pyrimidin-5-yl]ethanamine;hydrochloride (CAS 1948237-01-1) is a chemical compound with the molecular formula C7H9ClF3N3 and a molecular weight of 227.61 g/mol. IUPAC name: (1S)-1-[2-(trifluoromethyl)pyrimidin-5-yl]ethanamine;hydrochloride. InChIKey: UMNMHVJWNPIIAH-WCCKRBBISA-N.
| Molecular formula | C7H9ClF3N3 |
|---|---|
| Molecular weight | 227.61 g/mol |
| IUPAC name | (1S)-1-[2-(trifluoromethyl)pyrimidin-5-yl]ethanamine;hydrochloride |
| InChIKey | UMNMHVJWNPIIAH-WCCKRBBISA-N |
| SMILES | C[C@@H](C1=CN=C(N=C1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)