CAS 1196157-56-8 appears in our catalog under these names: 2-Amino-5-phenylnicotinic acid, 96%, 2-Amino-5-phenylnicotinic Acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 50mg, 0,5g.
2-amino-5-phenylpyridine-3-carboxylic acid (CAS 1196157-56-8) is a chemical compound with the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. IUPAC name: 2-amino-5-phenylpyridine-3-carboxylic acid. InChIKey: VYIQVVNTIQFCGW-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O2 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 2-amino-5-phenylpyridine-3-carboxylic acid |
| InChIKey | VYIQVVNTIQFCGW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(N=C2)N)C(=O)O |
Computed by PubChem (NCBI)