CAS 119644-22-3 appears in our catalog under these names: 5-Chloro-2',3'-dideoxy-3'-fluorouridine, Raluridine, 98%, Raluridine, 5-Chloro-1-((2R,4S,5R)-4-fluoro-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione, 98%, 98%, Raluridine, 99.53%. Offered by: Biosynth, AmBeed, TRC, GLPBio, Chemat. Available pack sizes: 10mg, 5mg, 25mg, 100mg, 50mg, 250mg, 1mg, 5 mg.
5-chloro-1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 119644-22-3) is a chemical compound with the molecular formula C9H10ClFN2O4 and a molecular weight of 264.64 g/mol. IUPAC name: 5-chloro-1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: WKVDSZYIGHLONN-RRKCRQDMSA-N.
| Molecular formula | C9H10ClFN2O4 |
|---|---|
| Molecular weight | 264.64 g/mol |
| IUPAC name | 5-chloro-1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | WKVDSZYIGHLONN-RRKCRQDMSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=C(C(=O)NC2=O)Cl)CO)F |
Computed by PubChem (NCBI)