CAS 2377034-16-5 is the registry number for 3-Amino-3-(2-fluoro-5-nitrophenyl)propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-amino-3-(2-fluoro-5-nitrophenyl)propanoic acid;hydrochloride (CAS 2377034-16-5) is a chemical compound with the molecular formula C9H10ClFN2O4 and a molecular weight of 264.64 g/mol. IUPAC name: 3-amino-3-(2-fluoro-5-nitrophenyl)propanoic acid;hydrochloride. InChIKey: XVVDEPTYDIAFCJ-UHFFFAOYSA-N.
| Molecular formula | C9H10ClFN2O4 |
|---|---|
| Molecular weight | 264.64 g/mol |
| IUPAC name | 3-amino-3-(2-fluoro-5-nitrophenyl)propanoic acid;hydrochloride |
| InChIKey | XVVDEPTYDIAFCJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(CC(=O)O)N)F.Cl |
Computed by PubChem (NCBI)