Products 2377034-16-5

CAS 2377034-16-5 is the registry number for 3-Amino-3-(2-fluoro-5-nitrophenyl)propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

3-amino-3-(2-fluoro-5-nitrophenyl)propanoic acid;hydrochloride (CAS 2377034-16-5) is a chemical compound with the molecular formula C9H10ClFN2O4 and a molecular weight of 264.64 g/mol. IUPAC name: 3-amino-3-(2-fluoro-5-nitrophenyl)propanoic acid;hydrochloride. InChIKey: XVVDEPTYDIAFCJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClFN2O4
Molecular weight264.64 g/mol
IUPAC name3-amino-3-(2-fluoro-5-nitrophenyl)propanoic acid;hydrochloride
InChIKeyXVVDEPTYDIAFCJ-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1[N+](=O)[O-])C(CC(=O)O)N)F.Cl

Computed by PubChem (NCBI)