CAS 119644-57-4 is the registry number for (E)-1-(3,4-Difluorophenyl)-5-(dimethylamino)-4-methylpent-1-en-3-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-1-(3,4-difluorophenyl)-5-(dimethylamino)-4-methylpent-1-en-3-one (CAS 119644-57-4) is a chemical compound with the molecular formula C14H17F2NO and a molecular weight of 253.29 g/mol. IUPAC name: (E)-1-(3,4-difluorophenyl)-5-(dimethylamino)-4-methylpent-1-en-3-one. InChIKey: KCCPYEKUXVMZAM-FNORWQNLSA-N.
| Molecular formula | C14H17F2NO |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | (E)-1-(3,4-difluorophenyl)-5-(dimethylamino)-4-methylpent-1-en-3-one |
| InChIKey | KCCPYEKUXVMZAM-FNORWQNLSA-N |
| SMILES | CC(CN(C)C)C(=O)/C=C/C1=CC(=C(C=C1)F)F |
Computed by PubChem (NCBI)