CAS 1405208-02-7 appears in our catalog under these names: 3-((2,4-Difluorophenyl)methyl)-8-azabicyclo(3.2.1)octan-3-ol, 98%, 3-((2,4-Difluorophenyl)methyl)-8-azabicyclo(3.2.1)octan-3-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-[(2,4-difluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-ol (CAS 1405208-02-7) is a chemical compound with the molecular formula C14H17F2NO and a molecular weight of 253.29 g/mol. IUPAC name: 3-[(2,4-difluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-ol. InChIKey: MPYYOEGUQPJLFE-UHFFFAOYSA-N.
| Molecular formula | C14H17F2NO |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | 3-[(2,4-difluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-ol |
| InChIKey | MPYYOEGUQPJLFE-UHFFFAOYSA-N |
| SMILES | C1CC2CC(CC1N2)(CC3=C(C=C(C=C3)F)F)O |
Computed by PubChem (NCBI)