Products 119694-48-3
CAS 119694-48-3 appears in our catalog under these names: Vildagliptin Impurity 38, Vildagliptin Impurity 31. Offered by: Chemat Brand. Available pack sizes: on request.
3,5,7-trinitroadamantan-1-amine (CAS 119694-48-3) is a chemical compound with the molecular formula C10H14N4O6 and a molecular weight of 286.24 g/mol. IUPAC name: 3,5,7-trinitroadamantan-1-amine. InChIKey: OZPJBZQGFWJBKJ-UHFFFAOYSA-N.
| Molecular formula | C10H14N4O6 |
|---|---|
| Molecular weight | 286.24 g/mol |
| IUPAC name | 3,5,7-trinitroadamantan-1-amine |
| InChIKey | OZPJBZQGFWJBKJ-UHFFFAOYSA-N |
| SMILES | C1C2(CC3(CC1(CC(C2)(C3)[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])N |
Computed by PubChem (NCBI)