CAS 58151-87-4 appears in our catalog under these names: Ribavirin EP Impurity F, Ribavirin Impurity 6（EP Impurity F）, 5’-O-Acetyl Ribavirin, 1-(5-O-Acetyl-beta-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide (5'-O-Acetylribavirin), 5'-O-Acetyl ribavirin. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 4x25mg.
[(2R,3S,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl acetate (CAS 58151-87-4) is a chemical compound with the molecular formula C10H14N4O6 and a molecular weight of 286.24 g/mol. IUPAC name: [(2R,3S,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl acetate. InChIKey: SSKIKIHFNHSINB-DAGMQNCNSA-N.
| Molecular formula | C10H14N4O6 |
|---|---|
| Molecular weight | 286.24 g/mol |
| IUPAC name | [(2R,3S,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl acetate |
| InChIKey | SSKIKIHFNHSINB-DAGMQNCNSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC(=N2)C(=O)N)O)O |
Computed by PubChem (NCBI)