CAS 1196989-82-8 is the registry number for 1,2-Bis((1H-1,2,4-triazol-1-yl)methyl)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[[2-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-1,2,4-triazole (CAS 1196989-82-8) is a chemical compound with the molecular formula C12H12N6 and a molecular weight of 240.26 g/mol. IUPAC name: 1-[[2-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-1,2,4-triazole. InChIKey: FFNPOCYAZAQCGK-UHFFFAOYSA-N.
| Molecular formula | C12H12N6 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 1-[[2-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-1,2,4-triazole |
| InChIKey | FFNPOCYAZAQCGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C=NC=N2)CN3C=NC=N3 |
Computed by PubChem (NCBI)