CAS 51772-75-9 is the registry number for Phenazine-2,3,7,8-tetraamine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Phenazine-2,3,7,8-tetramine (CAS 51772-75-9) is a chemical compound with the molecular formula C12H12N6 and a molecular weight of 240.26 g/mol. IUPAC name: phenazine-2,3,7,8-tetramine. InChIKey: RHMUOJFWSURTRJ-UHFFFAOYSA-N.
| Molecular formula | C12H12N6 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | phenazine-2,3,7,8-tetramine |
| InChIKey | RHMUOJFWSURTRJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=C1N=C3C=C(C(=CC3=N2)N)N)N)N |
Computed by PubChem (NCBI)