Products 1197205-71-2
CAS 1197205-71-2 appears in our catalog under these names: Docosahexaenoic Acid-d5 (>80%), Docosahexaenoic Acid–d5 MaxSpec• Standard, Docosahexaenoic Acid–d5, CIS-4,7,10,13,16,19-DOCOSAHEXAENOIC ACI&, Docosahexaenoic acid-d5, 99.71%. Offered by: TRC, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 2,5mg, 100μg, 50ug, 100ug, 500ug, 1mg, 5MG, 1 mg (1.50 mM * 2 mL in Ethanol).
(4Z,7Z,10Z,13Z,16Z,19Z)-21,21,22,22,22-pentadeuteriodocosa-4,7,10,13,16,19-hexaenoic acid (CAS 1197205-71-2) is a chemical compound with the molecular formula C22H32O2 and a molecular weight of 333.5 g/mol. IUPAC name: (4Z,7Z,10Z,13Z,16Z,19Z)-21,21,22,22,22-pentadeuteriodocosa-4,7,10,13,16,19-hexaenoic acid. InChIKey: MBMBGCFOFBJSGT-RPBOKJFVSA-N.
| Molecular formula | C22H32O2 |
|---|---|
| Molecular weight | 333.5 g/mol |
| IUPAC name | (4Z,7Z,10Z,13Z,16Z,19Z)-21,21,22,22,22-pentadeuteriodocosa-4,7,10,13,16,19-hexaenoic acid |
| InChIKey | MBMBGCFOFBJSGT-RPBOKJFVSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)O |
Computed by PubChem (NCBI)