CAS 1197237-07-2 is the registry number for ([(2,5-Difluorophenyl)methyl]sulfanyl)methanimidamide hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 200mg.
(2,5-difluorophenyl)methyl carbamimidothioate;hydrobromide (CAS 1197237-07-2) is a chemical compound with the molecular formula C8H9BrF2N2S and a molecular weight of 283.14 g/mol. IUPAC name: (2,5-difluorophenyl)methyl carbamimidothioate;hydrobromide. InChIKey: RHWQUGXUFBZEJE-UHFFFAOYSA-N.
| Molecular formula | C8H9BrF2N2S |
|---|---|
| Molecular weight | 283.14 g/mol |
| IUPAC name | (2,5-difluorophenyl)methyl carbamimidothioate;hydrobromide |
| InChIKey | RHWQUGXUFBZEJE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CSC(=N)N)F.Br |
Computed by PubChem (NCBI)