CAS 1326811-58-8 is the registry number for 3,4-Difluorobenzyl carbamimidothioate hydrobromide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3,4-difluorophenyl)methyl carbamimidothioate;hydrobromide (CAS 1326811-58-8) is a chemical compound with the molecular formula C8H9BrF2N2S and a molecular weight of 283.14 g/mol. IUPAC name: (3,4-difluorophenyl)methyl carbamimidothioate;hydrobromide. InChIKey: KMDZUGNPNVIOOQ-UHFFFAOYSA-N.
| Molecular formula | C8H9BrF2N2S |
|---|---|
| Molecular weight | 283.14 g/mol |
| IUPAC name | (3,4-difluorophenyl)methyl carbamimidothioate;hydrobromide |
| InChIKey | KMDZUGNPNVIOOQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CSC(=N)N)F)F.Br |
Computed by PubChem (NCBI)