CAS 1197239-39-6 is the registry number for 1-(2,2-Difluoroethyl)-3,5-dimethyl-1H-pyrazol-4-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(2,2-difluoroethyl)-3,5-dimethylpyrazol-4-amine;hydrochloride (CAS 1197239-39-6) is a chemical compound with the molecular formula C7H12ClF2N3 and a molecular weight of 211.64 g/mol. IUPAC name: 1-(2,2-difluoroethyl)-3,5-dimethylpyrazol-4-amine;hydrochloride. InChIKey: KJCXWKSHMFFHBX-UHFFFAOYSA-N.
| Molecular formula | C7H12ClF2N3 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | 1-(2,2-difluoroethyl)-3,5-dimethylpyrazol-4-amine;hydrochloride |
| InChIKey | KJCXWKSHMFFHBX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC(F)F)C)N.Cl |
Computed by PubChem (NCBI)