Products 2883043-84-1
CAS 2883043-84-1 is the registry number for 2-(1-(Difluoromethyl)-1H-pyrazol-3-yl)propan-2-amine xhydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[1-(difluoromethyl)pyrazol-3-yl]propan-2-amine;hydrochloride (CAS 2883043-84-1) is a chemical compound with the molecular formula C7H12ClF2N3 and a molecular weight of 211.64 g/mol. IUPAC name: 2-[1-(difluoromethyl)pyrazol-3-yl]propan-2-amine;hydrochloride. InChIKey: VVHYRQADOORYPX-UHFFFAOYSA-N.
| Molecular formula | C7H12ClF2N3 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | 2-[1-(difluoromethyl)pyrazol-3-yl]propan-2-amine;hydrochloride |
| InChIKey | VVHYRQADOORYPX-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=NN(C=C1)C(F)F)N.Cl |
Computed by PubChem (NCBI)