CAS 1197466-46-8 appears in our catalog under these names: 4-(Pyrrolidin-2-yl)phenol hydrobromide, 95%, 4-(Pyrrolidin-2-yl)phenol hydrobromide. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 0,5g, 50mg.
4-pyrrolidin-2-ylphenol;hydrobromide (CAS 1197466-46-8) is a chemical compound with the molecular formula C10H14BrNO and a molecular weight of 244.13 g/mol. IUPAC name: 4-pyrrolidin-2-ylphenol;hydrobromide. InChIKey: GTJSBHPOBQQBRS-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO |
|---|---|
| Molecular weight | 244.13 g/mol |
| IUPAC name | 4-pyrrolidin-2-ylphenol;hydrobromide |
| InChIKey | GTJSBHPOBQQBRS-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=CC=C(C=C2)O.Br |
Computed by PubChem (NCBI)