Products 119770-61-5
CAS 119770-61-5 appears in our catalog under these names: Desloratadine Impurity 22, Desloratadine Impurity 40. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
13-chloro-2-(1-methylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene (CAS 119770-61-5) is a chemical compound with the molecular formula C20H21ClN2 and a molecular weight of 324.8 g/mol. IUPAC name: 13-chloro-2-(1-methylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene. InChIKey: XEMDMASUIPFLDP-UHFFFAOYSA-N.
| Molecular formula | C20H21ClN2 |
|---|---|
| Molecular weight | 324.8 g/mol |
| IUPAC name | 13-chloro-2-(1-methylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
| InChIKey | XEMDMASUIPFLDP-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)C2C3=C(C=CC4=C2N=CC=C4)C=C(C=C3)Cl |
Computed by PubChem (NCBI)