Products 1346600-30-3
CAS 1346600-30-3 appears in our catalog under these names: Desloratadine Impurity 4, Desloratadine Impurity 49, Desloratadine Impurity 23, 8-Dechloro-7-chloro-N-methyl Desloratadine, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
12-chloro-2-(1-methylpiperidin-4-ylidene)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene (CAS 1346600-30-3) is a chemical compound with the molecular formula C20H21ClN2 and a molecular weight of 324.8 g/mol. IUPAC name: 12-chloro-2-(1-methylpiperidin-4-ylidene)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene. InChIKey: NCLUNMSJAAFQSD-UHFFFAOYSA-N.
| Molecular formula | C20H21ClN2 |
|---|---|
| Molecular weight | 324.8 g/mol |
| IUPAC name | 12-chloro-2-(1-methylpiperidin-4-ylidene)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| InChIKey | NCLUNMSJAAFQSD-UHFFFAOYSA-N |
| SMILES | CN1CCC(=C2C3=C(CCC4=C2N=CC=C4)C(=CC=C3)Cl)CC1 |
Computed by PubChem (NCBI)