Products 1197745-19-9
CAS 1197745-19-9 is the registry number for N,3-Dimethyl-N-((3-methylthiophen-2-yl)methyl)but-2-enamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N,3-dimethyl-N-[(3-methylthiophen-2-yl)methyl]but-2-enamide (CAS 1197745-19-9) is a chemical compound with the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. IUPAC name: N,3-dimethyl-N-[(3-methylthiophen-2-yl)methyl]but-2-enamide. InChIKey: NGALHGLMPDKDNE-UHFFFAOYSA-N.
| Molecular formula | C12H17NOS |
|---|---|
| Molecular weight | 223.34 g/mol |
| IUPAC name | N,3-dimethyl-N-[(3-methylthiophen-2-yl)methyl]but-2-enamide |
| InChIKey | NGALHGLMPDKDNE-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=C1)CN(C)C(=O)C=C(C)C |
Computed by PubChem (NCBI)