CAS 1197827-84-1 appears in our catalog under these names: 3-[3-(4-Bromothiophen-2-yl)-1,2,4-oxadiazol-5-yl]propanoic acid, 95%, 3-(3-(4-Bromothiophen-2-yl)-1,2,4-oxadiazol-5-yl)propanoic acid, 95%, 3-(3-(4-Bromothiophen-2-yl)-1,2,4-oxadiazol-5-yl)propanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
3-[3-(4-bromothiophen-2-yl)-1,2,4-oxadiazol-5-yl]propanoic acid (CAS 1197827-84-1) is a chemical compound with the molecular formula C9H7BrN2O3S and a molecular weight of 303.13 g/mol. IUPAC name: 3-[3-(4-bromothiophen-2-yl)-1,2,4-oxadiazol-5-yl]propanoic acid. InChIKey: PYAKZMXFESFQTN-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O3S |
|---|---|
| Molecular weight | 303.13 g/mol |
| IUPAC name | 3-[3-(4-bromothiophen-2-yl)-1,2,4-oxadiazol-5-yl]propanoic acid |
| InChIKey | PYAKZMXFESFQTN-UHFFFAOYSA-N |
| SMILES | C1=C(SC=C1Br)C2=NOC(=N2)CCC(=O)O |
Computed by PubChem (NCBI)