Products 2222511-75-1

CAS 2222511-75-1 is the registry number for 4-(4-Bromopyrazol-1-yl)benzenesulfonic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

4-(4-bromopyrazol-1-yl)benzenesulfonic acid (CAS 2222511-75-1) is a chemical compound with the molecular formula C9H7BrN2O3S and a molecular weight of 303.13 g/mol. IUPAC name: 4-(4-bromopyrazol-1-yl)benzenesulfonic acid. InChIKey: CCOMTFCUTIFUKZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7BrN2O3S
Molecular weight303.13 g/mol
IUPAC name4-(4-bromopyrazol-1-yl)benzenesulfonic acid
InChIKeyCCOMTFCUTIFUKZ-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1N2C=C(C=N2)Br)S(=O)(=O)O

Computed by PubChem (NCBI)